Alizarin Yellow R
From Wikipedia, the free encyclopedia
| Alizarin Yellow R | |
|---|---|
  |
|
| Systematic name | |
| Chemical formula | C13H8N3NaO5 |
| Molecular mass | 309.21 g mol−1 |
| Density | x.xxx g/cm³ |
| Melting point | xx.x °C |
| Boiling point | xx.x °C |
| CAS number | [1783-34-9] [2243-76-7] |
| SMILES | O=C([O-])c1cc(ccc1O)/N=N/ c2ccc(cc2)[N+]([O-])=O |
| Disclaimer and references | |
| Alizarin Yellow R (pH indicator) | ||
| below pH 10.1 | above pH 12.0 | |
| 10.1 | ↔ | 12.0 |
Alizarin Yellow R (Chrome Orange, Mordant Orange 1) is a yellow colored azo dye made by the diazo coupling reaction. It usually comes as a sodium salt. In its pure form it is a rust-colored solid. It is a pH indicator.
[edit] External links
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
